ChemNet > CAS > 41306-29-0 2- [3- 메틸 -2- (메틸 이미노) -4- 옥소 -1,3- 티아졸란 -5- 일] 아세트산
41306-29-0 2- [3- 메틸 -2- (메틸 이미노) -4- 옥소 -1,3- 티아졸란 -5- 일] 아세트산
| 상품명칭 |
2- [3- 메틸 -2- (메틸 이미노) -4- 옥소 -1,3- 티아졸란 -5- 일] 아세트산 |
| 별명 |
[(2Z)-3-메틸-2-(메틸이미노)-4-옥소-1,3-티아졸리딘-5-일]아세트산 |
| 영문 이름 |
2-[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolan-5-yl]acetic acid;[(2Z)-3-methyl-2-(methylimino)-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| 분자식 |
C7H10N2O3S |
| 분자량 |
202.2309 |
| InChI |
InChI=1/C7H10N2O3S/c1-8-7-9(2)6(12)4(13-7)3-5(10)11/h4H,3H2,1-2H3,(H,10,11)/b8-7- |
| cas번호 |
41306-29-0 |
| 분자 구조 |
|
| 밀도 |
1.47g/cm3 |
| 녹는 점 |
158℃ |
| 비등점 |
374.5°C at 760 mmHg |
| 굴절 지수 |
1.639 |
| 인화점 |
180.3°C |
| 증기압 |
1.22E-06mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|